| Identification | |
| Name: | Potassium acetate |
| Synonyms: | Polycat 46;Acetic acid,compounds,potassium salt;Catacyst LB;Kaliumazetat;Potassium Acetate, Granular, U.S.P.;Acetic acid, potassium salt; |
| CAS: | 127-08-2 |
| EINECS: | 204-822-2 |
| Molecular Formula: | C2H3KO2 |
| Molecular Weight: | 98.14 |
| InChI: | InChI=1/C2H4O2.K/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.57 |
| Stability: | Stability Deliquescent. Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.370 |
| Appearance: | colourless crystals or white powder |
| Specification: |
? Potassium Acetate , with CAS number of 127-08-2, can be called Polycat 46 ; Acetic acid,compounds,potassium salt ; Catacyst LB ; Kaliumazetat ; Potassium acetate (TN) ; Potassium Acetate, Granular, U.S.P ; Potassium acetate ; Acetic acid, potassium salt . It is a?colourless crystals or white powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Usage: | Extinguishing agent used in class k fire extinguishers, food preservative, a deicer - among its many uses. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
T: Toxic
|
 |
|
