| Identification |
| Name: | 2-Naphthalenamine,1,2,3,4-tetrahydro-8-methoxy-, (2S)- |
| Synonyms: | 2-Naphthalenamine,1,2,3,4-tetrahydro-8-methoxy-, (S)-;((2S)-8-Methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amine |
| CAS: | 127253-44-5 |
| Molecular Formula: | C11H15 N O |
| Molecular Weight: | 177.2429 |
| InChI: | InChI=1/C11H15NO/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11/h2-4,9H,5-7,12H2,1H3/t9-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 147.4ºC |
| Boiling Point: | 309.1 ºC at 760 mmHg |
| Density: | 1.056 g/cm3 |
| Refractive index: | 1.548 |
| Water Solubility: | at 25 deg C (mg/L): 2.707e+004 |
| Solubility: | at 25 deg C (mg/L): 2.707e+004 |
| Flash Point: | 147.4ºC |
| Safety Data |
| |
 |