| Identification | |
| Name: | Nevirapine |
| Synonyms: | 11-Cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2,3-e)(1,4)diazepin-6-one;Viramune;BIRG 0587;BI-RG-587;BI-RG-587;6H-Dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one,11-cyclopropyl-5,11-dihydro-4-methyl-;99% Nevirapine;Nevirapine [USAN:INN];BI-RG 587;BIRG 587;BIRG 0587;Viramune (TN);NVP;Nevirapine (JP14/USAN);11-Cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido;Viramune (Nevirapine); |
| CAS: | 129618-40-2 |
| Molecular Formula: | C15H14N4O |
| Molecular Weight: | 266.3 |
| InChI: | InChI=1/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.351 g/cm3 |
| Refractive index: | 1.671 |
| Solubility: | In water, 100 mg/l @ neutral pH |
| Appearance: | white or off-white crystalline powder |
| Specification: |
?Nevirapine , its cas register number is 129618-40-2. It also can be called?Viramune ; 11-Cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one ; 6H-Dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one, 11-cyclopropyl-5,11-dihydro-4-methyl- .It is a?crystalline solid.?It has also been tested in trials in Africa, some of which have been highly controversial. |
| Color: | Crystals from pyridine and water |
| Usage: | A potent (IC50=84nM) and selective non-nucleoside inhibitorf HIV-1 reverse transcriptase |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
