| Identification | |
| Name: | 1,4-Naphthoquinone |
| Synonyms: | 1,4-Naphthalenedione; 1,4-naphthoquinone (alpha); naphthoquinone; 1,4-Naphthaquinone |
| CAS: | 130-15-4 |
| EINECS: | 204-977-6 |
| Molecular Formula: | C10H6O2 |
| Molecular Weight: | 158.16 |
| InChI: | InChI=1/C10H6O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.42 |
| Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents. |
| Refractive index: | 1.617 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Yellow needles or brownish green powder with an odor of benzoquinone. |
| Packinggroup: | I |
| HS Code: | 29146910 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Yellow triclinic needles from alcohol or petroleum ether YELLOW POWDER Yellow crystals |
| Usage: | Polymerization regulator for rubber and polyester resins, synthesis of dyes and pharmaceuticals, algicide, fungicide. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
 |
|
