Identification |
Name: | (R,S)-2-AMINO-3-[3-(CARBOXYMETHOXY)-5-METHYL-ISOXAZOL-4-YL]-PROPIONIC ACID, SESQUIHYDRATE |
Synonyms: | AMOA;(R,S)-2-AMINO-3-[3-(CARBOXYMETHOXY)-5-METHYL-ISOXAZOL-4-YL]-PROPIONIC ACID, SESQUIHYDRATE;(R,S)-2-AMINO-3-[3-(CARBOXYMETHYL)-5-METHYLISOXAZOL-4-YL]PROPIONIC ACID SESQUIHYDRATE;(R,S)-2-Amino-3-(3-(carboxymethoxy)-5-methyl-isoxazol-4-yl)propionicacid;Sesquihydrate;2-amino-3-(3-(carboxymethoxy)-5-methylisoxazol-4-yl)propionic acid |
CAS: | 130146-18-8 |
Molecular Formula: | C18H30N4O15 |
Molecular Weight: | 542.45 |
InChI: | InChI=1/C9H12N2O6/c1-4-5(2-6(10)9(14)15)8(11-17-4)16-3-7(12)13/h6H,2-3,10H2,1H3,(H,12,13)(H,14,15) |
Molecular Structure: |
|
Properties |
Melting Point: | 230(dec.) |
Flash Point: | 257.6°C |
Boiling Point: | 502.4°C at 760 mmHg |
Density: | 1.481g/cm3 |
Refractive index: | 1.563 |
Flash Point: | 257.6°C |
Usage: | A selective inhibitor of [3H]-AMPA binding in rat brain membranes. AMOA shows little affinity for [3H]-kainate binding sites or other sites on the NMDA receptor-channel complex, as represented by binding of [3H]-CPP, [3H]-gly or [3H]-MK-801. AMOA |
Safety Data |
|
|