| Identification | |
| Name: | 1,1'-Biphenyl,2,2'-dichloro- |
| Synonyms: | Biphenyl,2,2'-dichloro- (6CI,7CI,8CI); 2,2'-DCBP; 2,2'-Dichloro-1,1'-biphenyl;2,2'-Dichlorobiphenyl; 2,2'-Dichlorodiphenyl; NSC 59902; PCB 4;o,o'-Dichlorobiphenyl |
| CAS: | 13029-08-8 |
| EINECS: | 215-648-1 |
| Molecular Formula: | C12H8 Cl2 |
| Molecular Weight: | 223.10 |
| InChI: | InChI=1/C12H8Cl2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2315 |
| Flash Point: | 122.4°C |
| Boiling Point: | 289.1°Cat760mmHg |
| Density: | 1.249g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
2,2'-Dichlorobiphenyl ,its cas register number is 13029-08-8. It also can be called Dichloro-1,1'-biphenyl ;and 1,1'-biphenyl, 2,2'-dichloro- . |
| Packinggroup: | II |
| Flash Point: | 122.4°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
