| Identification | |
| Name: | D-Phenylalanine methyl ester hydrochloride |
| Synonyms: | Methyl D-phenylalaninate hydrochloride (1:1);(R)-Phenylalanine methyl ester hydrochloride;Methyl(R)-phenylalaninate hydrochloride;Methyl D-phenylalaninate hydrochloride;Alanine,phenyl-, methyl ester, hydrochloride, D- (8CI);D-phenylalanine, methyl ester, hydrochloride (1:1); |
| CAS: | 13033-84-6 |
| EINECS: | 219-934-7 |
| Molecular Formula: | C10H14ClNO2 |
| Molecular Weight: | 215.68 |
| InChI: | InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1g/cm3 |
| Refractive index: | -37.0 ° (C=2, EtOH) |
| Appearance: | White Solid |
| Specification: |
D-Phenylalanine methyl ester hydrochloride , with CAS number of 13033-84-6, can be called Methyl D-phenylalaninate hydrochloride (1:1) ; (R)-Phenylalanine methyl ester hydrochloride ; Methyl(R)-phenylalaninate hydrochloride ; Methyl D-phenylalaninate hydrochloride ; Alanine,phenyl-, methyl ester, hydrochloride, D- (8CI) ; D-phenylalanine, methyl ester, hydrochloride (1:1) . It is a white powder. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
