| Identification |
| Name: | DL-2-Amino-1-butanol |
| Synonyms: | (+/-)-2-Amino-1-butanol; 2-Amino-1-butanol; DL-2-Aminobutanol |
| CAS: | 13054-87-0 |
| EINECS: | 235-940-2 |
| Molecular Formula: | C4H11NO |
| Molecular Weight: | 89.14 |
| InChI: | InChI=1S/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 8/PG 3 |
| Density: | 0.943 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.452 |
| Solubility: | Very soluble |
| Appearance: | Clear liquid. Faint amine odor. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
