| Identification |
| Name: | Urea,N'-methyl-N,N-diphenyl- |
| Synonyms: | Urea,3-methyl-1,1-diphenyl- (6CI,7CI,8CI);Acardit II;Acardite II;Akardit II;Akardite II;N-Methyl-N',N'-diphenylurea;N'-Methyl-N,N-diphenylurea; |
| CAS: | 13114-72-2 |
| EINECS: | 236-039-7 |
| Molecular Formula: | C14H14N2O |
| Molecular Weight: | 226.28 |
| InChI: | InChI=1/C14H14N2O/c1-15-14(17)16(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,17) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 100kgs |
| Melting Point: | 171 - 173 C |
| Density: | 1.151 g/cm3 |
| Refractive index: | 1.615 |
| Water Solubility: | Insoluble in water (soluble in acetone, ethanol and benzene) |
| Solubility: | Insoluble in water (soluble in acetone, ethanol and benzene) |
| Appearance: | White to grey crystalline powder |
| Safety Data |
| Hazard Symbols |
|
| |
 |
