Identification |
Name: | L-Glutamine, glycyl- |
Synonyms: | Glutamine,N2-glycyl-, L- (8CI);L-Glutamine, N2-glycyl-;Glycyl-L-glutamine; |
CAS: | 13115-71-4 |
Molecular Formula: | C7H13N3O4 |
Molecular Weight: | 221.21 |
InChI: | InChI=1/C7H13N3O4/c8-3-6(12)10-4(7(13)14)1-2-5(9)11/h4H,1-3,8H2,(H2,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 342.7 °C |
Boiling Point: | 643.1 °Cat760mmHg |
Density: | 1.359 g/cm3 |
Refractive index: | -7 ° (C=3, 1mol/L HCl) |
Alpha: | -6.5 º (C=10, 2N HCL) |
Solubility: | 154 g/L (20 ºC) |
Appearance: | white crystals or crystalline powder |
Specification: |
L-Glutamine, glycyl- , its cas register number 13115-71-4. It also can be called Glycyl-L-glutamine monohydrate ; and Glycylglutamine .
|
Flash Point: | 342.7 °C |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |