| Identification | |
| Name: | Hydrazine,(2,4-dichlorophenyl)- |
| Synonyms: | (2,4-Dichlorophenyl)hydrazine;1-(2,4-Dichlorophenyl)hydrazine |
| CAS: | 13123-92-7 |
| Molecular Formula: | C6H6 Cl2 N2 |
| Molecular Weight: | 177.03 |
| InChI: | InChI=1/C6H6Cl2N2/c7-4-1-2-6(10-9)5(8)3-4/h1-3,10H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.4°C |
| Boiling Point: | 268.8°C at 760 mmHg |
| Density: | 1.475g/cm3 |
| Refractive index: | 1.665 |
| Specification: |
2,4-Dichlorophenylhydrazine , its cas register number is 13123-92-7. It also can be called (1-(2,4-Dichlorophenyl)hydrazine ; and Hydrazine, (2,4-dichlorophenyl)- . |
| Flash Point: | 116.4°C |
| Safety Data | |
 |
|
