| Identification | |
| Name: | Tungsten(VI) oxide |
| Synonyms: | Tungsten trioxide; TungstenoxidePURATREMyellowpowder; Tungstenoxidesinteredlumpsyellowgreenpieces; Tungstenoxideyellowgreenpowder; Tungstenoxide |
| CAS: | 1314-35-8 |
| EINECS: | 215-231-4 |
| Molecular Formula: | WO3 |
| Molecular Weight: | 231.84 |
| InChI: | InChI=1/3O.W/rO3W/c1-4(2)3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | ~1700ºC |
| Density: | 7.16 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Appearance: | Yellow powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | °C |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | Canary yellow, heavy powder; dark orange when heated, regaining the original color on cooling Yellow, rhombic crystals, or yellow-orange powder |
| Usage: | Manufacture of tungstates which are used for x-ray screens and for fireproofing fabrics. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
