| Identification | |
| Name: | Vanillyl ethyl ether |
| Synonyms: | p-Cresol, a-ethoxy-2-methoxy- (7CI,8CI);4-(Ethoxymethyl)-2-methoxyphenol;4-Hydroxy-3-methoxybenzyl ethyl ether;Ethyl4-hydroxy-3-methoxybenzyl ether;Ethyl vanillyl ether;Phenol,4-(ethoxymethyl)-2-methoxy-; |
| CAS: | 13184-86-6 |
| EINECS: | 236-136-4 |
| Molecular Formula: | C10H14O3 |
| Molecular Weight: | 182.2164 |
| InChI: | InChI=1/C10H14O3/c1-3-13-7-8-4-5-9(11)10(6-8)12-2/h4-6,11H,3,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120.2 ºC |
| Boiling Point: | 275.2 ºC at 760 mmHg |
| Density: | 1.087 g/cm3 |
| Refractive index: | 1.517 |
| Water Solubility: | insoluble in water; soluble in organic solvents, oils |
| Solubility: | insoluble in water; soluble in organic solvents, oils |
| Appearance: | pale amber to yellow liquid with a phenolic, smoky odour |
| Specification: |
Vanillyl ethyl ether (CAS NO.13184-86-6), its Synonyms are Ethyl 4-hydroxy-3-methoxybenzyl ether ; Ethyl vanillyl ether ; P-Cresol, alpha-ethoxy-2-methoxy- ; Phenol, 4-(ethoxymethyl)-2-methoxy- ; alpha-Ethoxy-2-methoxy-P-cresol ; 4-(Ethoxymethyl)-2-methoxyphenol . |
| Flash Point: | 120.2 ºC |
| Safety Data | |
 |
|
