| Identification | |
| Name: | Dibenzothiophene |
| Synonyms: | Biphenylensulfide; Diphenylene sulphide |
| CAS: | 132-65-0 |
| EINECS: | 205-072-9 |
| Molecular Formula: | C12H8S |
| Molecular Weight: | 184.26 |
| InChI: | InChI=1/C12H8S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.252g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.756 |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE |
| Appearance: | Yellow to green solid. |
| Specification: |
9-Thiafluorene (132-65-0) is a fluorene derivative with the appearance of colourless crystals. It is insoluble in water but can be soluble in Benzene and other related organic solvents. 9-Thiafluorene (132-65-0) is produced by the reaction of Biphenyl and Sulfur dichloride.The Aluminium trichloride is added as catalyst at the same time. 9-Thiafluorene (132-65-0) is used as an intermediate in synthesis of many useful compounds. It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, dry place. |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Color: | white |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
