| Identification | |
| Name: | Nitric acid, dodecyl ester |
| Synonyms: | nitric acid, dodecyl ester |
| CAS: | 13277-59-3 |
| Molecular Formula: | C12H25NO3 |
| Molecular Weight: | 231.3318 |
| InChI: | InChI=1/C12H25NO3/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15/h2-12H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 86.1°C |
| Boiling Point: | 280.3°C at 760 mmHg |
| Density: | 0.941g/cm3 |
| Refractive index: | 1.445 |
| Specification: |
Nitric acid, dodecyl ester , its cas register number is 13277-59-3. It also can be called Dodecylester kyseliny dusicne ; and Lauryl nitrate . |
| Flash Point: | 86.1°C |
| Safety Data | |
 |
|
