| Identification |
| Name: | Propanedioicacid, 2-ethyl-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, ethyl-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, ethyl-, diethylester (9CI);2-Ethylmalonic acid diethyl ester;Diethyl 2-ethylmalonate;Diethyl a-ethylmalonate;Ethylpropanedioic acid diethyl ester;NSC 8706; |
| CAS: | 133-13-1 |
| EINECS: | 205-093-3 |
| Molecular Formula: | C9H16O4 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C9H16O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h7H,4-6H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.004 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.415-1.417 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | Clear, colorless liquid. |
| HS Code: | 29171990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
