| Identification | |
| Name: | 2,4-Dichlorobenzoyl peroxide |
| Synonyms: | 2,4-Dichlorobenzoylperoxide;2,4-Dichlorobibenzoyl peroxide;Bis(2,4-dichlorobenzoyl) peroxide;C 2 (crosslinking agent);Cadox TDP;Cadox TS;Cadox TS 50;Chaloxyd DCLBP50PSI;Elastosil AUX Crosslinker E;Elastosil AUX-E;Perkadox PD 50S;Siloprene CL 40;TC 2;TC 2 (peroxide);o,o',p,p'-Tetrachlorodibenzoyl peroxide; |
| CAS: | 133-14-2 |
| EINECS: | 205-094-9 |
| Molecular Formula: | C14H6Cl4O4 |
| Molecular Weight: | 380.00704 |
| InChI: | InChI=1S/C14H6Cl4O4/c15-7-1-3-9(11(17)5-7)13(19)21-22-14(20)10-4-2-8(16)6-12(10)18/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2137 |
| Density: | 1.26 |
| Stability: | No data. |
| Refractive index: | 1.617 |
| Water Solubility: | Soluble in benzene and chloroform, slightly soluble in alcohol, insoluble in water. |
| Solubility: | Soluble in benzene and chloroform, slightly soluble in alcohol, insoluble in water. |
| Appearance: | white paste |
| Specification: |
Bis(2,4-dichlorobenzoyl) peroxide (133-14-2) also can be called Bis(2,4-dichlorophenyl)peroxyanhydride ; 2,4-Dichlorobenzoyl peroxide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Chrosslinking agent. |
| Safety Data | |
 |
|
