| Identification | |
| Name: | Sodium tetraborate |
| Synonyms: | Boric acid(H2B4O7), disodium salt (8CI);Sodium tetraborate (Na2B4O7) (7CI);Anhydrousborax;Borax glass;Disodium tetraborate;FR 28;Fireless B;Fireless B Liquid;Fused Borax;Rasorite 65;Sodium biborate;Sodium boron oxide(Na2B4O7);Spraybor; |
| CAS: | 1330-43-4 |
| EINECS: | 215-540-4 |
| Molecular Formula: | Na2B4O7 |
| Molecular Weight: | 201.21 |
| InChI: | InChI=1/B4O7.2Na/c5-1-7-3-9-2(6)10-4(8-1)11-3;;/q-2;2*+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 8 |
| Density: | 2.367 |
| Stability: | Stable. Incompatible with powdered metals. |
| Refractive index: | 1.501 |
| Appearance: | white solid |
| Specification: |
???Sodium tetraborate (CAS No.1330-43-4), it also can be called Anhydrous borax ; Borax glass ; Borax, anhydrous ; Borax, dehydrated ; Borax, fused ; Disodium tetraborate .It is pale yellow solid or thick liquid with a faint odor of detergent. If mixes with water, Soap bubbles may be produced. |
| Report: |
? Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 28401100 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Hygroscopic |
| Usage: | Manufacture of glass, enamels, & other ceramic products. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
