| Identification | |
| Name: | Antimony oxide (Sb2O4) |
| Synonyms: | ATE-H;ATE-S;Antimony antimonate (Sb(SbO4));Antimony tetroxide(Sb2O4);Diantimony tetraoxide;Diantimony tetroxide;FOX-L;NA 5050;Sun EpochNA 5050;b-Antimony tetroxide; |
| CAS: | 1332-81-6 |
| EINECS: | 215-576-0 |
| Molecular Formula: | O4Sb2 |
| Molecular Weight: | 307.49 |
| InChI: | InChI=1/4O.2Sb/rO4Sb2/c1-5-4-6(2)3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1549 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 5.82 |
| Specification: |
The Antimony oxide with the cas number 1332-81-6, is also called dioxo(oxostibanyloxy)-λ5-stibane named bu IUPAC. And it's system names is Diantimony tetraoxide. When you are using it, please be cautious because it is quite irritating to eyes, respiratory system and skin. Wear suitable protective clothing. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. Physical properties about this chemical are: (1)#H bond acceptors: 4 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 2 ; (4)Polar Surface Area: 60.44Å2 You can still convert the following datas into molecular structure : |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
