| Identification |
| Name: | 1-Butanol,4-(dimethylamino)- |
| Synonyms: | 4-(Dimethylamino)-1-butanol;4-(Dimethylamino)butanol;N,N-Dimethyl-4-aminobutanol;NSC 165645; |
| CAS: | 13330-96-6 |
| EINECS: | 236-380-1
|
| Molecular Formula: | C6H15NO |
| Molecular Weight: | 117.1894 |
| InChI: | InChI=1S/C6H15NO/c1-7(2)5-3-4-6-8/h8H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 326 |
| Flash Point: | 45.7°C |
| Boiling Point: | 188 C
|
| Density: | 0.885g/cm3 |
| Refractive index: | 1.443 |
| Water Solubility: | soluble (soluble in ethanol and ether) |
| Solubility: | soluble (soluble in ethanol and ether) |
| Appearance: | clear liquid |
| Flash Point: | 45.7°C |
| Safety Data |
| Hazard Symbols |
8 (Packing Group: II)
UN
NO.
|
| |
 |
