Identification |
Name: | L-Leucinamide,N-[(phenylmethoxy)carbonyl]-L-leucyl-N-[(1S)-1-formyl-3-methylbutyl]- |
Synonyms: | L-Leucinamide,N-[(phenylmethoxy)carbonyl]-L-leucyl-N-(1-formyl-3-methylbutyl)-, (S)-;MG 132; |
CAS: | 133407-82-6 |
Molecular Formula: | C26H41N3O5 |
Molecular Weight: | 475.62084 |
InChI: | InChI=1S/C26H41N3O5/c1-17(2)12-21(15-30)27-24(31)22(13-18(3)4)28-25(32)23(14-19(5)6)29-26(33)34-16-20-10-8-7-9-11-20/h7-11,15,17-19,21-23H,12-14,16H2,1-6H3,(H,27,31)(H,28,32)(H,29,33)/t21-,22-,23-/m0/s1 |
Molecular Structure: |
|
Properties |
Density: | 1.073 g/cm3 |
Refractive index: | 1.506 |
Water Solubility: | methanol: 1 mg/mL in water |
Solubility: | methanol: 1 mg/mL in water |
Appearance: | White to off-white powder |
Biological Activity: | Potent cell-permeable inhibitor of proteasome (IC 50 = 100 nM) and calpain (IC 50 = 1.2 μ M). Inhibits TNF- α -induced NF- κ B activation and I κ B α degradation. Induces neurite outgrowth in PC12 cells and has anticancer properties in vitro . |
Safety Data |
|
|