| Identification |
| Name: | stearic acid, monoester with butanediol |
| Synonyms: | Octadecanoic acid, monoester with butanediol;Stearic acid, monoester with butanediol;4-hydroxybutyl octadecanoate |
| CAS: | 1335-20-2 |
| EINECS: | 215-624-0 |
| Molecular Formula: | C22H44O3 |
| Molecular Weight: | 356.583 |
| InChI: | InChI=1/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)25-21-18-17-20-23/h23H,2-21H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 167.4°C |
| Boiling Point: | 454.2°C at 760 mmHg |
| Density: | 0.908g/cm3 |
| Refractive index: | 1.458 |
| Flash Point: | 167.4°C |
| Safety Data |
| |
 |
