| Identification | |
| Name: | Methyl anthranilate |
| Synonyms: | Methyl 2-Aminobenzoate; Methl-O-Aminobenzoate; 2-Aminobenzoic acid methyl ester; Anthranilic acid methyl ester; Anthranilic acid methylester |
| CAS: | 134-20-3 |
| EINECS: | 205-132-4 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 100kg |
| Density: | 1.168 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.581-1.584 |
| Water Solubility: | slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | pale yellow to dark liquid |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Air Sensitive |
| Color: | Crystals Pale-yellow liquid with bluish fluorescence Colorless to pale yellow liquid or solid |
| Usage: | As perfume for ointments, manufacture synthetic perfumes. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
