| Identification |
| Name: | 4-Methylbenzophenone |
| Synonyms: | p-Methylbenzophenone;4-Methyl benzophenone;Benzophenone, 4-methyl-;Phenyl p-tolyl ketone;Methanone, (4-methylphenyl)phenyl-;p-Benzophenone, methyl-;cyclohexyl-(4-methylphenyl)methanone;(4-methylphenyl)-phenyl-methanone;p-Benzoyltoluene;Photoinitiator-4MBP;phenyl(p-tolyl)methanone; |
| CAS: | 134-84-9 |
| EINECS: | 205-159-1 |
| Molecular Formula: | C14H12O |
| Molecular Weight: | 196.25 |
| InChI: | InChI=1/C14H12O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Density: | 1.067 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.534 |
| Water Solubility: | Insoluble AUTOIGNITION |
| Solubility: | Insoluble |
| Appearance: | white to slightly yellow powder |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| |
 |
