| Identification | |
| Name: | 4-Chlorobenzophenone |
| Synonyms: | Benzophenone, 4-chloro- (8CI);para-Chlorobenzophenone;(4-chlorophenyl)-phenyl-methanone;Benzophenone, 4-chloro-;p-CBP;Methanone, (4-chlorophenyl)phenyl-;4-Chloro-benzophenone;Methanone; |
| CAS: | 134-85-0 |
| EINECS: | 205-160-7 |
| Molecular Formula: | C13H9ClO |
| Molecular Weight: | 216.67 |
| InChI: | InChI=1/C13H9ClO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.207 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
??p-Chlorobenzophenone ,?its cas register number is 134-85-0. It also can be called?4-Chlorobenzophenone ; AI3-00705 ; |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Needles from alcohol White to off-white, crystalline powder |
| Safety Data | |
| Hazard Symbols | |
 |
|
