| Identification | |
| Name: | 3,5-Dimethoxy-4-hydroxybenzaldehyde |
| CAS: | 134-96-3 |
| EINECS: | 205-167-5 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C9H10O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-5,11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.013 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.567 |
| Water Solubility: | very sparingly soluble |
| Solubility: | very sparingly soluble |
| Appearance: | light yellow-green to brown crystalline powder |
| Specification: |
3,5-Dimethoxy-4-hydroxybenzaldehyde , with CAS number of 134-96-3, can be called 2,6-Dimethoxy-4-formylphenol ; 4-Hydroxy-3,5-dimethoxybenzaldehyd ; 4-Hydroxy-3,5-dimethoxybenzaldehyde ; 4-Hydroxy-3,5-diméthoxybenzaldéhyde ; 4-Hydroxy-3,5-dimethoxybenzolcarbaldehyd ; benzaldehyde, 4-hydroxy-3,5-dimethoxy- . It is a light yellow-green to brown crystalline powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29124900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Usage: | Some species of insects use syringaldehyde in their chemical communication systems. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
