| Identification |
| Name: | Methanone,phenyl-2-thienyl- |
| Synonyms: | Ketone,phenyl 2-thienyl (6CI,7CI,8CI);2-Benzoylthiophene;2-Thienyl phenyl ketone;NSC 4502;Phenyl 2-thienyl ketone;Phenyl(2-thienyl)methanone;a-Benzoylthiophene; |
| CAS: | 135-00-2 |
| EINECS: | 205-169-6 |
| Molecular Formula: | C11H8OS |
| Molecular Weight: | 188.24 |
| InChI: | InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 56-58 °C(lit.)
|
| Flash Point: | 139.7°C |
| Boiling Point: | 300 °C(lit.)
|
| Density: | 1.198g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.609 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of any toxic |
| Solubility: | |
| Appearance: | off-white to tan powder |
| Flash Point: | 139.7°C |
| Safety Data |
| |
 |
