Identification |
Name: | Thiazolium,3-[(3,4-dihydro-2-methyl-4-oxo-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl- |
Synonyms: | Thiazolium,3-[(1,4-dihydro-2-methyl-4-oxo-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl-(9CI); Thiazolium,5-(2-hydroxyethyl)-3-[(4-hydroxy-2-methyl-5-pyrimidinyl)methyl]-4-methyl-(8CI); 4'-Oxythiamin; Hydroxythiamin; Oxythiamin; Oxythiamine |
CAS: | 136-16-3 |
Molecular Formula: | C12H16 N3 O2 S |
Molecular Weight: | 266.37 |
InChI: | InChI=1/C12H15N3O2S.ClH/c1-8-11(3-4-16)18-7-15(8)6-10-5-13-9(2)14-12(10)17;/h5,7,16H,3-4,6H2,1-2H3;1H |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Specification: |
Oxythiamine (CAS NO.136-16-3) differs from thiamine in having the amino group in the pyrimidine ring replaced by a hydroxyl group and that is a thiamine antagonist producing symptoms of thiamine deficiency.
|
Flash Point: | °C |
Storage Temperature: | −20°C |
Safety Data |
|
|