| Identification |
| Name: | 1H-Benzotriazole,6-methyl- |
| Synonyms: | 1H-Benzotriazole,5-methyl- (8CI,9CI);Benzotriazole, 5-methyl- (6CI,7CI);5-Methyl-1,2,3-benzotriazole;5-Methyl-1H-benzo[d][1,2,3]triazole;5-Methyl-1H-benzotriazole;5-Methylbenzotriazole;5-Tolyltriazole;6-Methyl-1,2,3-benzotriazole;6-Tolyltriazole;NSC 122012;TTA;Tolutriazole; |
| CAS: | 136-85-6 |
| EINECS: | 205-265-8 |
| Molecular Formula: | C7H7N3 |
| Molecular Weight: | 133.15 . CODE |
| InChI: | InChI=1S/C7H7N3/c1-5-2-3-6-7(4-5)9-10-8-6/h2-4H,1H3,(H,8,9,10) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Melting Point: | 80-84 oC |
| Boiling Point: | 210-212 oC (12 mmHg) |
| Density: | 1.273g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | 6.0 G/L (25 ºC) |
| Solubility: | 6.0 g/L |
| Appearance: | white to pale yellow needle-like powder |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
