| Identification |
| Name: | 2-Thiophenecarboxaldehyde,5-methyl- |
| Synonyms: | 2-Formyl-5-methylthiophene;2-Methyl-5-formylthiophene;2-Methylthiophene-5-carboxaldehyde;5-Methyl-2-formylthiophene;5-Methyl-2-thienaldehyde;5-Methyl-2-thienylcarbaldehyde;5-Methyl-2-thiophenealdehyde;5-Methylthiophene-2-carbaldehyde;NSC 87542; |
| CAS: | 13679-70-4 |
| EINECS: | 237-178-6 |
| Molecular Formula: | C6H6OS |
| Molecular Weight: | 126.17 |
| InChI: | InChI=1/C6H6OS/c1-5-2-3-6(4-7)8-5/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.18 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5815-1.5835 |
| Solubility: | Slightly soluble |
| Appearance: | Clear amber liquid. |
| HS Code: | 29349990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
