| Identification | |
| Name: | o-Toluenethiol |
| Synonyms: | 2-Methylbenzenethiol; 2-Methylthiophenol; o-Thiocresol; 2-Thiocresol; 2-Mercaptotoluene; 2-mercapto-toluen; 2-Methybenzenethiol; 2-methyl-benzenethio; 2-methylmercaptobenzene; 2-methylphenylmercaptan; 2-Toluenethiol; Benzenethiol,2-methyl-; o-Mercaptotoluene |
| CAS: | 137-06-4 |
| EINECS: | 205-276-8 |
| Molecular Formula: | C7H8S |
| Molecular Weight: | 124.2 |
| InChI: | InChI=1/C7H8S/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.054 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.579-1.581 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | brown clear liquid. |
| Specification: |
o-Toluenethiol (CAS NO.137-06-4), its Synonyms are 2-Methylbenzenethiol ; 2-Methylphenylthiol ; 2-Methylthiophenol ; 2-Toluenethiol ; Benzenethiol, 2-methyl- ; o-Mercaptotoluene ; o-Methylbenzenethiol ; o-Methylthiophenol ; o-Thiocresol ; Toluene, 2-mercapto- ; Tolylmercaptan, o- ; Tolylthiol, o- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Stench |
| Usage: | Antiseptic, dermatologic unspecified isomer. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
