| Identification | |
| Name: | Quinazoline,4-chloro-6,7-dimethoxy- |
| Synonyms: | 6,7-Dimethoxy-4-chloroquinazoline; |
| CAS: | 13790-39-1 |
| Molecular Formula: | C10H9ClN2O2 |
| Molecular Weight: | 224.65 |
| InChI: | InChI=1/C10H9ClN2O2/c1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.8°C |
| Boiling Point: | 345.5°Cat760mmHg |
| Density: | 1.321g/cm3 |
| Refractive index: | 1.605 |
| Appearance: | white or almost white power |
| Specification: |
4-Chloro-6,7-dimethoxyquinazoline (CAS No.13790-39-1), it also can be called Quinazoline, 4-chloro-6,7-dimethoxy- ; 4-Chlor-6,7-dimethoxychinazolin . |
| Flash Point: | 162.8°C |
| Usage: |
4-Chloro-6,7-dimethoxyquinazoline (CAS No.13790-39-1), it can be used as synthetic intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
