| Identification | |
| Name: | Aminopropanol pyrocatecholhydrochloride |
| Synonyms: | 3,4-dihydroxynorephedrinehydrochloride;3,4-dihydroxyphenylaminopropanolhydrochloride;3,4-dihydroxyphenylpropanolaminehydrochloride;alpha-(1-aminoethyl)-3,4-dihydroxy-benzylalcohohydrochloride;alpha-(1-aminoethyl)-3,4-dihydroxybenzylalcoholhydrochloride;alpha-methylnoradrenalinehydrochloride;aminopropanolpyrocatecholhydrochloride;cobefrinhydrochloride |
| CAS: | 138-61-4 |
| EINECS: | 205-336-3 |
| Molecular Formula: | C9H13NO3 . ClH |
| Molecular Weight: | 219.66536 |
| InChI: | InChI=1/C9H13NO3.ClH/c1-5(10)9(13)6-2-3-7(11)8(12)4-6;/h2-5,9,11-13H,10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214.8°C |
| Boiling Point: | 431.6°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Aminopropanol pyrocatecholhydrochloride ,its CAS number is 138-61-4,it can be called 4-(2-Amino-1-hydroxypropyl)benzene-1,2-diol hydrochloride (1:1) ; a-(1-Aminoethyl)-3,4-dihydroxybenzyl Alcohol Hydrochloride ; Ammonium 2-(benzamidooxy)acetate ; a-Methylnorepinephrine Hydrochloride . It is a toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides and hydrogen chloride,so it should be stored in cool and dry environment,separate from food and materials.Dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 214.8°C |
| Safety Data | |
 |
|
