| Identification | |
| Name: | 1,2-Benzenediol,4-(2-amino-1-hydroxyethyl)- |
| CAS: | 138-65-8 |
| EINECS: | 200-229-8 |
| Molecular Formula: | C8H11 N O3 |
| Molecular Weight: | 169.20 |
| InChI: | InChI=1/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.397 g/cm3 |
| Refractive index: | 1.659 |
| Specification: |
DL-arterenol with cas registry number of 138-65-8 is also known as DL-norepinephrine ; DL-noradrenaline ; 1,2-Benzenediol,4-(2-amino-1-hydroxy)-,(dl)- ; 1,2-Benzenediol,4-(2-amino-1-hydroxyethyl)- ; 1,2-Benzenediol,4-(2-amino-1-hydroxyethyl)-,(.+/-.)- ; 4-(2-Amino-1-hydroxyethyl)-1,2-benzenediol ; 4-Dihydroxy-alpha-(aminomethyl)-(+-)-benzylalcoho . It is a solid that can be soluble in water. It is used as a medicine to prevent shock, but it also may caused a rise of mean pulmonary artery pressure. In addition, it is a pharmaceutical Intermediate which is used to produce many useful medicines. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
|
 |
|
