| Identification | |
| Name: | Phenol,4,4'-(1,2-diarsenediyl)bis[2-amino-, hydrochloride (1:2) |
| Synonyms: | Phenol,4,4'-(1,2-diarsenediyl)bis[2-amino-, dihydrochloride (9CI); Phenol, 4,4'-arsenobis[2-amino-,dihydrochloride (8CI); Arsabenzosol; Arsaminol; Arsenphenolamine hydrochloride;Arsphenamine; Diarsenol; Ehrlich 606; Eparsenol; Kharsivan; NSC 3097; Novarsol;Phenarsenamine; Salvarsan; Sanluol; Tanvarsan |
| CAS: | 139-93-5 |
| EINECS: | 205-386-6 |
| Molecular Formula: | C12H12 As2 N2 O2 . 2 Cl H |
| Molecular Weight: | 439.02 |
| InChI: | InChI=1/C12H12As2N2O2.2ClH/c15-9-5-7(1-3-11(9)17)13-14-8-2-4-12(18)10(16)6-8;;/h1-6,17-18H,15-16H2;2*1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
 |
|
