| Identification |
| Name: | Phenol,3-[(1S)-1-(dimethylamino)ethyl]- |
| Synonyms: | Phenol,3-[1-(dimethylamino)ethyl]-, (S)-;(S)-3-[1-(Dimethylamino)ethyl]phenol;NAP226-90; |
| CAS: | 139306-10-8 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.23 |
| InChI: | InChI=1/C10H15NO/c1-8(11(2)3)9-5-4-6-10(12)7-9/h4-8,12H,1-3H3/t8-/m0/s1 |
| Molecular Structure: |
![(C10H15NO) Phenol,3-[1-(dimethylamino)ethyl]-, (S)-;(S)-3-[1-(Dimethylamino)ethyl]phenol;NAP226-90;](https://img.guidechem.com/casimg/139306-10-8.gif) |
| Properties |
| Flash Point: | 93.6°C |
| Boiling Point: | 237.3°Cat760mmHg |
| Density: | 1.041g/cm3 |
| Refractive index: | 1.539 |
| Appearance: | off-white to pale yellow crystal |
| Flash Point: | 93.6°C |
| Usage: | S-Enantiomer metabolite of Rivastigmine, a brain selective acetylcholinesterase inhibitor |
| Safety Data |
| |
 |
