| Identification | |
| Name: | Ethanaminium,2-hydroxy-N,N,N-trimethyl-, 2-propylpentanoate (1:1) |
| Synonyms: | Choline,salt with 2-propylvaleric acid (1:1) (8CI); Ethanaminium,2-hydroxy-N,N,N-trimethyl-, salt with 2-propylpentanoic acid (1:1) (9CI);Pentanoic acid, 2-propyl-, ion(1-), 2-hydroxy-N,N,N-trimethylethanaminium(9CI); Valeric acid, 2-propyl-, ion(1-), choline (8CI); Choline a,a-dipropylacetate |
| CAS: | 13943-50-5 |
| Molecular Formula: | C8 H15 O2 |
| Molecular Weight: | 248.3817 |
| InChI: | InChI=1/C8H16O2.C5H14NO/c1-3-5-7(6-4-2)8(9)10;1-6(2,3)4-5-7/h7H,3-6H2,1-2H3,(H,9,10);7H,4-5H2,1-3H3/q;+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.6°C |
| Boiling Point: | 220°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 116.6°C |
| Safety Data | |
 |
|
