| Identification |
| Name: | Methan-d3-amine,N,N-di(methyl-d3)- (9CI) |
| Synonyms: | Trimethyl-d9-ammonium-15N chloride; |
| CAS: | 13960-80-0 |
| Molecular Formula: | C3D9N |
| Molecular Weight: | 68.17 |
| InChI: | InChI=1/C3H9N/c1-4(2)3/h1-3H3/i1D3,2D3,3D3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1083 2.1 |
| Melting Point: | −117 °C(lit.)
|
| Flash Point: | °C |
| Boiling Point: | 3-4 °C(lit.)
|
| Density: | 0.799g/cm3 |
| Stability: | Stable. Extremely flammable. Incompatible with strong oxidizing agents, acids, acid anhydrides, many metals and alloys, bases, acid chlorides. |
| Refractive index: | 1.378 |
| Solubility: | |
| Flash Point: | °C |
| Safety Data |
| Hazard Symbols |
|
| |
 |
