| Identification | |
| Name: | 1,4-Pentanediamine,N1,N1-diethyl- |
| Synonyms: | 1-(Diethylamino)-4-aminopentane;1-Methyl-4-(diethylamino)butylamine;2-Amino-5-(diethylamino)pentane;2-Amino-5-diethylamino-n-pentane;4-(Diethylamino)-1-methylbutylamine;4-Amino-1-(diethylamino)pentane;5-(Diethylamino)-2-pentanamine;5-(Diethylamino)-2-pentylamine;N,N-Diethyl-1,4-pentanediamine;N1,N1-Diethyl-1,4-pentanediamine;N5,N5-Diethyl-2,5-pentanediamine;NSC 2606;Novoldiamine;d-(Diethylamino)-a-methylbutylamine; |
| CAS: | 140-80-7 |
| EINECS: | 205-435-1 |
| Molecular Formula: | C9H22 N2 |
| Molecular Weight: | 158.29 |
| InChI: | InChI=1/C9H22N2/c1-4-11(5-2)8-6-7-9(3)10/h9H,4-8,10H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2946 |
| Flash Point: | 155? |
| Density: | 0.817 |
| Stability: | No data. |
| Refractive index: | 1.4429 |
| Solubility: | Soluble |
| Appearance: | Colorless clear liquid |
| Packinggroup: | III |
| Flash Point: | 155? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
