| Identification | |
| Name: | Carbonodithioic acid,O-(1-methylethyl) ester, potassium salt (1:1) |
| Synonyms: | Carbonicacid, dithio-, O-isopropyl ester, potassium salt (8CI); Carbonodithioic acid,O-(1-methylethyl) ester, potassium salt (9CI); Isopropyl potassium xanthate;Isopropylxanthic acid potassium salt; O-Isopropyl dithiocarbonate potassiumsalt; Potassium O-isopropyldithiocarbonate; Potassium isopropyldithiocarbonate; Potassium isopropyl xanthanate; Potassium isopropylxanthogenate; Potassium isopropylxanthate |
| CAS: | 140-92-1 |
| EINECS: | 205-441-4 |
| Molecular Formula: | C4H8 O S2 . K |
| Molecular Weight: | 174.33 |
| InChI: | InChI=1/C4H8OS2.K/c1-3(2)5-4(6)7;/h3H,1-2H3,(H,6,7); |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3342 |
| Melting Point: | 264 °C (dec.)(lit.) |
| Flash Point: | 37.2°C |
| Boiling Point: | 138°Cat760mmHg |
| Density: | 1.132g/cm3 |
| Specification: |
Isopropyl potassium xanthate (140-92-1),which also can be called for Isopropylxanthic acid potassium salt ; Carbonicacid,dithio-,o-isopropylester,potassiumsalt ; Carbonodithioicacid,o-(1methylethyl)ester,potassiumsalt ; Carbonodithioicacid,O-(1-methylethyl)ester,potassiumsalt ; Dithiocarbonicacid,o-isopropylester,potassiumsalt ; Dithiocarbonicacido-isopropylesterpotassiumsalt ; Isopropylpotassiumxanthate ; Isopropyl-xanthicacipotassiumsalt .When Isopropyl potassium xanthate (140-92-1) was heated,it emits toxic vapors of SOx . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 37.2°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
