Identification |
Name: | b-D-Mannopyranoside, octyl O-a-D-mannopyranosyl-(1®3)-O-[a-D-mannopyranosyl-(1®6)]- |
Synonyms: | octyl3,6diO(mannopyranosyl)mannopyranoside;Man1a6[Man1a3]ManOOctyl;nOctyl3,6DiO(aDmannopyranosyl)Dmannopyranoside |
CAS: | 140147-36-0 |
Molecular Formula: | C26H48 O16 |
Molecular Weight: | 0 |
InChI: | InChI=1/C26H48O16/c1-2-3-4-5-6-7-8-37-25-22(36)23(42-26-21(35)19(33)16(30)13(10-28)40-26)17(31)14(41-25)11-38-24-20(34)18(32)15(29)12(9-27)39-24/h12-36H,2-11H2,1H3 |
Molecular Structure: |
![(C26H48O16) octyl3,6diO(mannopyranosyl)mannopyranoside;Man1a6[Man1a3]ManOOctyl;nOctyl3,6DiO(aDmannopyranosyl)Dma...](https://img1.guidechem.com/chem/e/dict/34/140147-36-0.jpg) |
Properties |
Flash Point: | 480.5°C |
Boiling Point: | 870.9°Cat760mmHg |
Density: | 1.48g/cm3 |
Refractive index: | 1.597 |
Flash Point: | 480.5°C |
Usage: | An acceptor for the assay of N-Acetylglucosaminyltransferase-1. A useful diagnostic for autosomal recessive congenital muscular dystrophies that can have associated brain and eye abnormalities. |
Safety Data |
|
 |