| Identification | |
| Name: | Acetamide,N-[3-(2,5-dihydro-5-thioxo-1H-tetrazol-1-yl)phenyl]- |
| Synonyms: | Acetanilide,3'-(5-mercapto-1H-tetrazol-1-yl)- (8CI);1-(3-Acetamidophenyl)-2-tetrazoline-5-thione;1-(3-Acetamidophenyl)-5-mercaptotetrazole;1-(m-Acetamidophenyl)-5-mercaptotetrazole; FOG 0901 |
| CAS: | 14070-48-5 |
| EINECS: | 237-924-0 |
| Molecular Formula: | C9H9 N5 O S |
| Molecular Weight: | 235.26 |
| InChI: | InChI=1/C9H9N5OS/c1-6(15)10-7-3-2-4-8(5-7)14-9(16)11-12-13-14/h2-5H,1H3,(H,10,15)(H,11,13,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1325 |
| Melting Point: | 185-187 ºC |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.51 g/cm3 |
| Refractive index: | 1.747 |
| Appearance: | white to light yellow powder |
| Specification: |
N-(3-(2,5-Dihydro-5-thioxo-1H-tetrazol-1-yl)phenyl)acetamide , its CAS NO. is 14070-48-5, the synonyms are EINECS 237-924-0 ; Acetamide, N-(3-(2,5-dihydro-5-thioxo-1H-tetrazol-1-yl)phenyl)- . |
| Flash Point: | °C |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xn: Harmful
|
 |
|
