| Identification | |
| Name: | Phenylalanine, 4-bromo- |
| Synonyms: | DL-p-Bromophenylalanine;p-Bromo-DL-phenylalanine; |
| CAS: | 14091-15-7 |
| EINECS: | 237-941-3 |
| Molecular Formula: | C9H10BrNO2 |
| Molecular Weight: | 244.09 |
| InChI: | InChI=1/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 176.6°C |
| Boiling Point: | 368.4°Cat760mmHg |
| Density: | 1.588g/cm3 |
| Refractive index: | 1.608 |
| Appearance: | white powder |
| Specification: |
Phenylalanine, 4-bromo- with cas registry number of 14091-15-7 is white powder, also called p-Bromo-DL-phenylalanine . |
| Flash Point: | 176.6°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
