| Identification | |
| Name: | Benzo-15-crown-5 |
| Synonyms: | 2,3,5,6,8,9,11,12-Octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin; Benzo-15-crown-5-ether |
| CAS: | 14098-44-3 |
| EINECS: | 237-947-6 |
| Molecular Formula: | C14H20O5 |
| Molecular Weight: | 268.31 |
| InChI: | InChI=1/C14H20O5/c1-2-4-14-13(3-1)18-11-9-16-7-5-15-6-8-17-10-12-19-14/h1-4H,5-12H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | DS. |
| Flash Point: | 165.9°C |
| Boiling Point: | 399.2°Cat760mmHg |
| Density: | 1.068g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.465 |
| Water Solubility: | partially soluble |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29329995 |
| Flash Point: | 165.9°C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
