| Identification | |
| Name: | 6-Octen-1-ol,3,7-dimethyl-, 1-propanoate |
| Synonyms: | 6-Octen-1-ol,3,7-dimethyl-, propanoate (9CI);6-Octen-1-ol, 3,7-dimethyl-, propionate(7CI,8CI);Propionic acid, ester with citronellol (6CI);Citronellolpropanoate; |
| CAS: | 141-14-0 |
| EINECS: | 205-461-3 |
| Molecular Formula: | C13H24O2 |
| Molecular Weight: | 212.33 |
| InChI: | InChI=1/C13H24O2/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h7,12H,5-6,8-10H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 90.8°C |
| Boiling Point: | 276.8°Cat760mmHg |
| Density: | 0.883g/cm3 |
| Refractive index: | n20/D 1.444(lit.) |
| Specification: |
The chemical synonyms of 3,7-Dimethyloct-6-enyl propanoate (CAS NO.141-14-0) are 3,7-Dimethyl-6-octen-1-yl propionate ; Fema 2316 ; Citronellyl propionate ; 3,7-Dimethyl-6-octen-1-olpropanoate ; 3,7-Dimethyl-6-octen-1-opropanoate ; 3,7-Dimethyl-6-octen-1-opropionate ; 3,7-Dimethyl-6-octenyl propionate ; 6-Octen-1-ol, 3,7-dimethyl-, propionate . |
| Flash Point: | 90.8°C |
| Safety Data | |
 |
|
