| Identification | |
| Name: | Diethyl adipate |
| Synonyms: | Adipicacid, diethyl ester (6CI,8CI);Hexanedioic acid, diethyl ester (9CI);Hexanedioic acid,1,6-diethyl ester;Diethyl hexanedioate;Ethyl adipate;Ethyl d-carboethoxyvalerate;NSC 19160;NSC 3363; |
| CAS: | 141-28-6 |
| EINECS: | 205-477-0 |
| Molecular Formula: | C10H18O4 |
| Molecular Weight: | 202.25 |
| InChI: | InChI=1/C10H18O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.009 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.426-1.428 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | colorless liquid. |
| Specification: |
Diethyl adipate , its cas register number is 141-28-6. It also can be called 1,6-Diethyl hexanedioate ; Diethyl adipatate ; Diethyl1,6-hexanedioate ; Diethylester kyseliny adipove ; Diethylesterkyselinyadipove ; Ethyl delta-carboethoxyvalerate ; Ethyldelta-carboethoxyvalerate ; Ethyl adipate . It should be kept in container closed when not in use and stored in a cool, dry, well-ventilated area away from incompatible substances. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 29171290 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless liquid |
| Usage: | Plasticizer. |
| Safety Data | |
 |
|
