| Identification | |
| Name: | malonic acid |
| Synonyms: | Propanedioic acid; Methane dicardonic acid; Methanadicarboxylic acid; Carboxyacetic acid |
| CAS: | 141-82-2 |
| EINECS: | 205-503-0 |
| Molecular Formula: | C3H4O4 |
| Molecular Weight: | 104.06 |
| InChI: | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Density: | 1.619 |
| Stability: | Stable. Incompatible with oxidizing agents, reducing agents, bases. |
| Solubility: | 1400 g/L (20 oC) |
| Appearance: | white crystalline powder |
| Specification: |
? Malonic acid?with cas registry number of 141-82-2 is? is a carboxylic acid, also called for?AI3-15375 ; Carboxyacetic acid ; Dicarboxymethane ; Kyselina malonova ; Kyselina malonova [Czech] ; MALONIC ACID ; Methanedicarboxylic acid ; NSC 8124 ; Propanedioic acid ; USAF EK-695 . It can be prepared in this way: Sodium carbonate generates the sodium salt which is then reacted with sodium cyanide to provide the cyano acetic acid salt via a nucleophilic substitution. The nitrile group can be hydrolyzed with sodium hydroxide to sodium malonate and acidification affords malonic acid. |
| Packinggroup: | III |
| HS Code: | 29171910 |
| Storage Temperature: | Store at RT. |
| Usage: | Malonic acid is used as building block in chemical synthesis, specifically to introduce the molecular group -CH2-COOH. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
