| Identification | |
| Name: | Diethylbenzene |
| Synonyms: | 1,3-Diethylbenzene |
| CAS: | 141-93-5 |
| EINECS: | 205-511-4 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.22 |
| InChI: | InChI=1/C10H14/c1-3-9-6-5-7-10(4-2)8-9/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2049 |
| Melting Point: | -84.2 |
| Flash Point: | 50.6 ºC |
| Boiling Point: | 181.7 ºC at 760 mmHg |
| Density: | 0.864 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.496 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid with an aromatic odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 50.6 ºC |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry,well-ventilated area away from incompatible substances. |
| Usage: | Intermediate, solvent diethylbenzene. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
