| Identification |
| Name: | Propanedioic acid,sodium salt (1:2) |
| Synonyms: | Malonicacid, disodium salt (8CI);Propanedioic acid, disodium salt (9CI);Disodiummalonate;Sodium malonate; |
| CAS: | 141-95-7 |
| EINECS: | 205-514-0 |
| Molecular Formula: | C3H2Na2O4 |
| Molecular Weight: | 104.06146 |
| InChI: | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 201.9°C |
| Boiling Point: | 386.8°Cat760mmHg |
| Density: | 1.546g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May act as a skin or eye irritant. Toxicity data (The meaning of any abbreviations which |
| Solubility: | |
| Appearance: | white crystalline powder |
| Flash Point: | 201.9°C |
| Safety Data |
| |
 |
