| Identification |
| Name: | Propanedinitrile,2-[2-[4-[(4R)-1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl]phenyl]hydrazinylidene]- |
| Synonyms: | Propanedinitrile,[[4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]hydrazono]-, (R)-;Propanedinitrile,[[4-[(4R)-1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl]phenyl]hydrazono]-(9CI);(-)-OR 1259;(R)-Simendan;OR 1259;Simdax; |
| CAS: | 141505-33-1 |
| Molecular Formula: | C14H12N6O |
| Molecular Weight: | 280.2898 |
| InChI: | InChI=1/C14H12N6O/c1-9-6-13(21)19-20-14(9)10-2-4-11(5-3-10)17-18-12(7-15)8-16/h2-5,9,17H,6H2,1H3,(H,19,21)/t9-/m1/s1 |
| Molecular Structure: |
![(C14H12N6O) Propanedinitrile,[[4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]hydrazono]-, (R)-;Propa...](https://img.guidechem.com/casimg/141505-33-1.gif) |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.33g/cm3 |
| Refractive index: | 1.673 |
| Solubility: | Insoluble |
| Appearance: | yellow crystalline powder |
| Flash Point: | °C |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | Bioactive enantiomer of racemate, Simendan. Positive inotropic agent with vasodilating activity. Cardiotonic |
| Safety Data |
| |
 |